About 2-[9-(2-methylphenoxy)carbonylacridin-10-ium-10-yl]acetic acid;trifluoromethanesulfonate
2-[9-(2-methylphenoxy)carbonylacridin-10-ium-10-yl]acetic acid;trifluoromethanesulfonate (PubChem CID 15250604) has the molecular formula C24H18F3NO7S
and a molecular weight of 521.47 g/mol. Its IUPAC name is 2-[9-(2-methylphenoxy)carbonylacridin-10-ium-10-yl]acetic acid;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | 2-[9-(2-methylphenoxy)carbonylacridin-10-ium-10-yl]acetic acid;trifluoromethanesulfonate |
| PubChem CID | 15250604 |
| Molecular Formula | C24H18F3NO7S |
| Molecular Weight | 521.47 g/mol |
| Exact Mass | 521.08 |
| IUPAC Name | 2-[9-(2-methylphenoxy)carbonylacridin-10-ium-10-yl]acetic acid;trifluoromethanesulfonate |
| SMILES | Cc1ccccc1OC(=O)c1c2ccccc2[n+](CC(=O)O)c2ccccc12.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C23H17NO4.CHF3O3S/c1-15-8-2-7-13-20(15)28-23(27)22-16-9-3-5-11-18(16)24(14-21(25)26)19-12-6-4-10-17(19)22;2-1(3,4)8(5,6)7/h2-13H,14H2,1H3;(H,5,6,7) |
| InChIKey | YWLPTNROSNYPCG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 521.47 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 2-[9-(2-methylphenoxy)carbonylacridin-10-ium-10-yl]acetic acid;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[9-(2-methylphenoxy)carbonylacridin-10-ium-10-yl]acetic acid;trifluoromethanesulfonate?
The IUPAC name of 2-[9-(2-methylphenoxy)carbonylacridin-10-ium-10-yl]acetic acid;trifluoromethanesulfonate (CID 15250604) is 2-[9-(2-methylphenoxy)carbonylacridin-10-ium-10-yl]acetic acid;trifluoromethanesulfonate.
What is the SMILES notation for 2-[9-(2-methylphenoxy)carbonylacridin-10-ium-10-yl]acetic acid;trifluoromethanesulfonate?
The canonical SMILES for 2-[9-(2-methylphenoxy)carbonylacridin-10-ium-10-yl]acetic acid;trifluoromethanesulfonate is Cc1ccccc1OC(=O)c1c2ccccc2[n+](CC(=O)O)c2ccccc12.O=S(=O)([O-])C(F)(F)F.
What is the InChIKey of 2-[9-(2-methylphenoxy)carbonylacridin-10-ium-10-yl]acetic acid;trifluoromethanesulfonate?
The InChIKey is YWLPTNROSNYPCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17NO4.CHF3O3S/c1-15-8-2-7-13-20(15)28-23(27)22-16-9-3-5-11-18(16)24(14-21(25)26)19-12-6-4-10-17(19)22;2-1(3,4)8(5,6)7/h2-13H,14H2,1H3;(H,5,6,7).
What are the key properties of 2-[9-(2-methylphenoxy)carbonylacridin-10-ium-10-yl]acetic acid;trifluoromethanesulfonate?
2-[9-(2-methylphenoxy)carbonylacridin-10-ium-10-yl]acetic acid;trifluoromethanesulfonate has a molecular weight of 521.47 g/mol, XLogP of 3.94, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[9-(2-methylphenoxy)carbonylacridin-10-ium-10-yl]acetic acid;trifluoromethanesulfonate is sourced from PubChem (CID 15250604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).