About oxo-[(2,3,6-trimethylphenyl)methylidene]phosphanium
oxo-[(2,3,6-trimethylphenyl)methylidene]phosphanium (PubChem CID 152506957) has the molecular formula C10H12OP+
and a molecular weight of 179.18 g/mol. Its IUPAC name is oxo-[(2,3,6-trimethylphenyl)methylidene]phosphanium.
Molecular Properties
| Compound Name | oxo-[(2,3,6-trimethylphenyl)methylidene]phosphanium |
| PubChem CID | 152506957 |
| Molecular Formula | C10H12OP+ |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | oxo-[(2,3,6-trimethylphenyl)methylidene]phosphanium |
| SMILES | Cc1ccc(C)c(C=[P+]=O)c1C |
| InChI | InChI=1S/C10H12OP/c1-7-4-5-8(2)10(6-12-11)9(7)3/h4-6H,1-3H3/q+1 |
| InChIKey | BKPOISUBEAOEDJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze oxo-[(2,3,6-trimethylphenyl)methylidene]phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxo-[(2,3,6-trimethylphenyl)methylidene]phosphanium?
The IUPAC name of oxo-[(2,3,6-trimethylphenyl)methylidene]phosphanium (CID 152506957) is oxo-[(2,3,6-trimethylphenyl)methylidene]phosphanium.
What is the SMILES notation for oxo-[(2,3,6-trimethylphenyl)methylidene]phosphanium?
The canonical SMILES for oxo-[(2,3,6-trimethylphenyl)methylidene]phosphanium is Cc1ccc(C)c(C=[P+]=O)c1C.
What is the InChIKey of oxo-[(2,3,6-trimethylphenyl)methylidene]phosphanium?
The InChIKey is BKPOISUBEAOEDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12OP/c1-7-4-5-8(2)10(6-12-11)9(7)3/h4-6H,1-3H3/q+1.
What are the key properties of oxo-[(2,3,6-trimethylphenyl)methylidene]phosphanium?
oxo-[(2,3,6-trimethylphenyl)methylidene]phosphanium has a molecular weight of 179.18 g/mol, XLogP of 3.05, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for oxo-[(2,3,6-trimethylphenyl)methylidene]phosphanium is sourced from PubChem (CID 152506957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).