C25H30O2S — CID 15250744
(7R,8R,9S,10R,13S,14S)-10,13-dimethyl-7-phenylsulfanyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 15250744) has the molecular formula C25H30O2S and a molecular weight of 394.58 g/mol. Its IUPAC name is (7R,8R,9S,10R,13S,14S)-10,13-dimethyl-7-phenylsulfanyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (7R,8R,9S,10R,13S,14S)-10,13-dimethyl-7-phenylsulfanyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 15250744 |
| Molecular Formula | C25H30O2S |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | (7R,8R,9S,10R,13S,14S)-10,13-dimethyl-7-phenylsulfanyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C[C@]12CCC(=O)C=C1C[C@@H](Sc1ccccc1)[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C25H30O2S/c1-24-12-10-17(26)14-16(24)15-21(28-18-6-4-3-5-7-18)23-19-8-9-22(27)25(19,2)13-11-20(23)24/h3-7,14,19-21,23H,8-13,15H2,1-2H3/t19-,20-,21+,23-,24-,25-/m0/s1 |
| InChIKey | ZSWNULGLLRDKKW-RGJWXQDMSA-N |
| XLogP | 5.86 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |