About (4-fluoro-3aH-1,3-benzodioxol-4-yl)-dihydroperoxyborane
(4-fluoro-3aH-1,3-benzodioxol-4-yl)-dihydroperoxyborane (PubChem CID 152508109) has the molecular formula C7H8BFO6
and a molecular weight of 217.94 g/mol. Its IUPAC name is (4-fluoro-3aH-1,3-benzodioxol-4-yl)-dihydroperoxyborane.
Molecular Properties
| Compound Name | (4-fluoro-3aH-1,3-benzodioxol-4-yl)-dihydroperoxyborane |
| PubChem CID | 152508109 |
| Molecular Formula | C7H8BFO6 |
| Molecular Weight | 217.94 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | (4-fluoro-3aH-1,3-benzodioxol-4-yl)-dihydroperoxyborane |
| SMILES | OOB(OO)C1(F)C=CC=C2OCOC21 |
| InChI | InChI=1S/C7H8BFO6/c9-7(8(14-10)15-11)3-1-2-5-6(7)13-4-12-5/h1-3,6,10-11H,4H2 |
| InChIKey | YEXDJGHSQPYHRX-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.94 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze (4-fluoro-3aH-1,3-benzodioxol-4-yl)-dihydroperoxyborane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluoro-3aH-1,3-benzodioxol-4-yl)-dihydroperoxyborane?
The IUPAC name of (4-fluoro-3aH-1,3-benzodioxol-4-yl)-dihydroperoxyborane (CID 152508109) is (4-fluoro-3aH-1,3-benzodioxol-4-yl)-dihydroperoxyborane.
What is the SMILES notation for (4-fluoro-3aH-1,3-benzodioxol-4-yl)-dihydroperoxyborane?
The canonical SMILES for (4-fluoro-3aH-1,3-benzodioxol-4-yl)-dihydroperoxyborane is OOB(OO)C1(F)C=CC=C2OCOC21.
What is the InChIKey of (4-fluoro-3aH-1,3-benzodioxol-4-yl)-dihydroperoxyborane?
The InChIKey is YEXDJGHSQPYHRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8BFO6/c9-7(8(14-10)15-11)3-1-2-5-6(7)13-4-12-5/h1-3,6,10-11H,4H2.
What are the key properties of (4-fluoro-3aH-1,3-benzodioxol-4-yl)-dihydroperoxyborane?
(4-fluoro-3aH-1,3-benzodioxol-4-yl)-dihydroperoxyborane has a molecular weight of 217.94 g/mol, XLogP of 0.53, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluoro-3aH-1,3-benzodioxol-4-yl)-dihydroperoxyborane is sourced from PubChem (CID 152508109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).