C23H44F6O3Si2 — CID 152510567
6,8-bis(2,2,2-trifluoro-1-trimethylsilyloxyethyl)tridecan-7-one (PubChem CID 152510567) has the molecular formula C23H44F6O3Si2 and a molecular weight of 538.76 g/mol. Its IUPAC name is 6,8-bis(2,2,2-trifluoro-1-trimethylsilyloxyethyl)tridecan-7-one.
| Compound Name | 6,8-bis(2,2,2-trifluoro-1-trimethylsilyloxyethyl)tridecan-7-one |
|---|---|
| PubChem CID | 152510567 |
| Molecular Formula | C23H44F6O3Si2 |
| Molecular Weight | 538.76 g/mol |
| Exact Mass | 538.27 |
| IUPAC Name | 6,8-bis(2,2,2-trifluoro-1-trimethylsilyloxyethyl)tridecan-7-one |
| SMILES | CCCCCC(C(=O)C(CCCCC)C(O[Si](C)(C)C)C(F)(F)F)C(O[Si](C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C23H44F6O3Si2/c1-9-11-13-15-17(20(22(24,25)26)31-33(3,4)5)19(30)18(16-14-12-10-2)21(23(27,28)29)32-34(6,7)8/h17-18,20-21H,9-16H2,1-8H3 |
| InChIKey | YFKJRNLVKBXAEK-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.76 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|