C18H21BN4O2 — CID 152510571
3-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]methyl]-1,5-naphthyridine (PubChem CID 152510571) has the molecular formula C18H21BN4O2 and a molecular weight of 336.20 g/mol. Its IUPAC name is 3-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]methyl]-1,5-naphthyridine.
| Compound Name | 3-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]methyl]-1,5-naphthyridine |
|---|---|
| PubChem CID | 152510571 |
| Molecular Formula | C18H21BN4O2 |
| Molecular Weight | 336.20 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 3-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]methyl]-1,5-naphthyridine |
| SMILES | CC1(C)OB(c2cnn(Cc3cnc4cccnc4c3)c2)OC1(C)C |
| InChI | InChI=1S/C18H21BN4O2/c1-17(2)18(3,4)25-19(24-17)14-10-22-23(12-14)11-13-8-16-15(21-9-13)6-5-7-20-16/h5-10,12H,11H2,1-4H3 |
| InChIKey | YFKKFEYBYYEVPZ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.20 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|