C9H5F9N2 — CID 152512709
2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)pyridin-3-amine (PubChem CID 152512709) has the molecular formula C9H5F9N2 and a molecular weight of 312.14 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)pyridin-3-amine.
| Compound Name | 2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)pyridin-3-amine |
|---|---|
| PubChem CID | 152512709 |
| Molecular Formula | C9H5F9N2 |
| Molecular Weight | 312.14 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)pyridin-3-amine |
| SMILES | Nc1cccnc1C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H5F9N2/c10-6(11,5-4(19)2-1-3-20-5)7(12,13)8(14,15)9(16,17)18/h1-3H,19H2 |
| InChIKey | YFVUVXPEMCEHBX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.14 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|