C8H10N4O3S — CID 152517599
3-ethoxy-1,1-dioxopyrido[4,3-e][1,2,4]thiadiazin-4-amine (PubChem CID 152517599) has the molecular formula C8H10N4O3S and a molecular weight of 242.26 g/mol. Its IUPAC name is 3-ethoxy-1,1-dioxopyrido[4,3-e][1,2,4]thiadiazin-4-amine.
| Compound Name | 3-ethoxy-1,1-dioxopyrido[4,3-e][1,2,4]thiadiazin-4-amine |
|---|---|
| PubChem CID | 152517599 |
| Molecular Formula | C8H10N4O3S |
| Molecular Weight | 242.26 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 3-ethoxy-1,1-dioxopyrido[4,3-e][1,2,4]thiadiazin-4-amine |
| SMILES | CCOC1=NS(=O)(=O)c2cnccc2N1N |
| InChI | InChI=1S/C8H10N4O3S/c1-2-15-8-11-16(13,14)7-5-10-4-3-6(7)12(8)9/h3-5H,2,9H2,1H3 |
| InChIKey | YGVUTLMBAOBGHZ-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 97.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.26 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|