C22H27F3N6O5S — CID 152518033
[3-(methoxymethoxy)-4-[3-(2,2,6,6-tetramethylpiperidin-4-yl)triazolo[4,5-c]pyridazin-6-yl]phenyl] trifluoromethanesulfonate (PubChem CID 152518033) has the molecular formula C22H27F3N6O5S and a molecular weight of 544.56 g/mol. Its IUPAC name is [3-(methoxymethoxy)-4-[3-(2,2,6,6-tetramethylpiperidin-4-yl)triazolo[4,5-c]pyridazin-6-yl]phenyl] trifluoromethanesulfonate.
| Compound Name | [3-(methoxymethoxy)-4-[3-(2,2,6,6-tetramethylpiperidin-4-yl)triazolo[4,5-c]pyridazin-6-yl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 152518033 |
| Molecular Formula | C22H27F3N6O5S |
| Molecular Weight | 544.56 g/mol |
| Exact Mass | 544.17 |
| IUPAC Name | [3-(methoxymethoxy)-4-[3-(2,2,6,6-tetramethylpiperidin-4-yl)triazolo[4,5-c]pyridazin-6-yl]phenyl] trifluoromethanesulfonate |
| SMILES | COCOc1cc(OS(=O)(=O)C(F)(F)F)ccc1-c1cc2nnn(C3CC(C)(C)NC(C)(C)C3)c2nn1 |
| InChI | InChI=1S/C22H27F3N6O5S/c1-20(2)10-13(11-21(3,4)29-20)31-19-17(27-30-31)9-16(26-28-19)15-7-6-14(8-18(15)35-12-34-5)36-37(32,33)22(23,24)25/h6-9,13,29H,10-12H2,1-5H3 |
| InChIKey | YGXYJZQLWFJWKS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 130.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.56 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|