About 2-(3-but-1-enoxypropyl)-4,4-dimethoxyoxane
2-(3-but-1-enoxypropyl)-4,4-dimethoxyoxane (PubChem CID 152520167) has the molecular formula C14H26O4
and a molecular weight of 258.36 g/mol. Its IUPAC name is 2-(3-but-1-enoxypropyl)-4,4-dimethoxyoxane.
Molecular Properties
| Compound Name | 2-(3-but-1-enoxypropyl)-4,4-dimethoxyoxane |
| PubChem CID | 152520167 |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 2-(3-but-1-enoxypropyl)-4,4-dimethoxyoxane |
| SMILES | CCC=COCCCC1CC(OC)(OC)CCO1 |
| InChI | InChI=1S/C14H26O4/c1-4-5-9-17-10-6-7-13-12-14(15-2,16-3)8-11-18-13/h5,9,13H,4,6-8,10-12H2,1-3H3 |
| InChIKey | YHIXGTQTAMCUET-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-but-1-enoxypropyl)-4,4-dimethoxyoxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-but-1-enoxypropyl)-4,4-dimethoxyoxane?
The IUPAC name of 2-(3-but-1-enoxypropyl)-4,4-dimethoxyoxane (CID 152520167) is 2-(3-but-1-enoxypropyl)-4,4-dimethoxyoxane.
What is the SMILES notation for 2-(3-but-1-enoxypropyl)-4,4-dimethoxyoxane?
The canonical SMILES for 2-(3-but-1-enoxypropyl)-4,4-dimethoxyoxane is CCC=COCCCC1CC(OC)(OC)CCO1.
What is the InChIKey of 2-(3-but-1-enoxypropyl)-4,4-dimethoxyoxane?
The InChIKey is YHIXGTQTAMCUET-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O4/c1-4-5-9-17-10-6-7-13-12-14(15-2,16-3)8-11-18-13/h5,9,13H,4,6-8,10-12H2,1-3H3.
What are the key properties of 2-(3-but-1-enoxypropyl)-4,4-dimethoxyoxane?
2-(3-but-1-enoxypropyl)-4,4-dimethoxyoxane has a molecular weight of 258.36 g/mol, XLogP of 2.88, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-but-1-enoxypropyl)-4,4-dimethoxyoxane is sourced from PubChem (CID 152520167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).