C16H14Cl3NO4 — CID 15252142
2-[(2R,4S)-2-methoxy-2-methyl-6-(trichloromethyl)-3,4-dihydropyran-4-yl]isoindole-1,3-dione (PubChem CID 15252142) has the molecular formula C16H14Cl3NO4 and a molecular weight of 390.65 g/mol. Its IUPAC name is 2-[(2R,4S)-2-methoxy-2-methyl-6-(trichloromethyl)-3,4-dihydropyran-4-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2R,4S)-2-methoxy-2-methyl-6-(trichloromethyl)-3,4-dihydropyran-4-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 15252142 |
| Molecular Formula | C16H14Cl3NO4 |
| Molecular Weight | 390.65 g/mol |
| Exact Mass | 389.00 |
| IUPAC Name | 2-[(2R,4S)-2-methoxy-2-methyl-6-(trichloromethyl)-3,4-dihydropyran-4-yl]isoindole-1,3-dione |
| SMILES | CO[C@@]1(C)C[C@H](N2C(=O)c3ccccc3C2=O)C=C(C(Cl)(Cl)Cl)O1 |
| InChI | InChI=1S/C16H14Cl3NO4/c1-15(23-2)8-9(7-12(24-15)16(17,18)19)20-13(21)10-5-3-4-6-11(10)14(20)22/h3-7,9H,8H2,1-2H3/t9-,15-/m1/s1 |
| InChIKey | BAAKIHCNIDJAOX-RFAUZJTJSA-N |
| XLogP | 3.69 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.65 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|