C17H28O2S — CID 152521772
2-(2-butyloctyl)thieno[2,3-d][1,3]dioxole (PubChem CID 152521772) has the molecular formula C17H28O2S and a molecular weight of 296.48 g/mol. Its IUPAC name is 2-(2-butyloctyl)thieno[2,3-d][1,3]dioxole.
| Compound Name | 2-(2-butyloctyl)thieno[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 152521772 |
| Molecular Formula | C17H28O2S |
| Molecular Weight | 296.48 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 2-(2-butyloctyl)thieno[2,3-d][1,3]dioxole |
| SMILES | CCCCCCC(CCCC)CC1Oc2ccsc2O1 |
| InChI | InChI=1S/C17H28O2S/c1-3-5-7-8-10-14(9-6-4-2)13-16-18-15-11-12-20-17(15)19-16/h11-12,14,16H,3-10,13H2,1-2H3 |
| InChIKey | YHRFJWWUZYKRRV-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.48 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|