C15H29NO — CID 152521875
2,2,6,6-tetramethyl-4-prop-1-enoxy-1-propylpiperidine (PubChem CID 152521875) has the molecular formula C15H29NO and a molecular weight of 239.40 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-4-prop-1-enoxy-1-propylpiperidine.
| Compound Name | 2,2,6,6-tetramethyl-4-prop-1-enoxy-1-propylpiperidine |
|---|---|
| PubChem CID | 152521875 |
| Molecular Formula | C15H29NO |
| Molecular Weight | 239.40 g/mol |
| Exact Mass | 239.22 |
| IUPAC Name | 2,2,6,6-tetramethyl-4-prop-1-enoxy-1-propylpiperidine |
| SMILES | CC=COC1CC(C)(C)N(CCC)C(C)(C)C1 |
| InChI | InChI=1S/C15H29NO/c1-7-9-16-14(3,4)11-13(17-10-8-2)12-15(16,5)6/h8,10,13H,7,9,11-12H2,1-6H3 |
| InChIKey | YHRQMGHADXIUII-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.40 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|