About 3,7-dihydropyrrolo[2,3-h]quinazolin-4-one
3,7-dihydropyrrolo[2,3-h]quinazolin-4-one (PubChem CID 152522842) has the molecular formula C10H7N3O
and a molecular weight of 185.19 g/mol. Its IUPAC name is 3,7-dihydropyrrolo[2,3-h]quinazolin-4-one.
Molecular Properties
| Compound Name | 3,7-dihydropyrrolo[2,3-h]quinazolin-4-one |
| PubChem CID | 152522842 |
| Molecular Formula | C10H7N3O |
| Molecular Weight | 185.19 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | 3,7-dihydropyrrolo[2,3-h]quinazolin-4-one |
| SMILES | O=c1[nH]cnc2c1ccc1[nH]ccc12 |
| InChI | InChI=1S/C10H7N3O/c14-10-7-1-2-8-6(3-4-11-8)9(7)12-5-13-10/h1-5,11H,(H,12,13,14) |
| InChIKey | YHWVRXDPKONMNN-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.19 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,7-dihydropyrrolo[2,3-h]quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dihydropyrrolo[2,3-h]quinazolin-4-one?
The IUPAC name of 3,7-dihydropyrrolo[2,3-h]quinazolin-4-one (CID 152522842) is 3,7-dihydropyrrolo[2,3-h]quinazolin-4-one.
What is the SMILES notation for 3,7-dihydropyrrolo[2,3-h]quinazolin-4-one?
The canonical SMILES for 3,7-dihydropyrrolo[2,3-h]quinazolin-4-one is O=c1[nH]cnc2c1ccc1[nH]ccc12.
What is the InChIKey of 3,7-dihydropyrrolo[2,3-h]quinazolin-4-one?
The InChIKey is YHWVRXDPKONMNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N3O/c14-10-7-1-2-8-6(3-4-11-8)9(7)12-5-13-10/h1-5,11H,(H,12,13,14).
What are the key properties of 3,7-dihydropyrrolo[2,3-h]quinazolin-4-one?
3,7-dihydropyrrolo[2,3-h]quinazolin-4-one has a molecular weight of 185.19 g/mol, XLogP of 1.40, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dihydropyrrolo[2,3-h]quinazolin-4-one is sourced from PubChem (CID 152522842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).