C25H52N2O7Si2 — CID 152523333
1,3-bis(1-triethoxysilylcyclohexyl)urea (PubChem CID 152523333) has the molecular formula C25H52N2O7Si2 and a molecular weight of 548.87 g/mol. Its IUPAC name is 1,3-bis(1-triethoxysilylcyclohexyl)urea.
| Compound Name | 1,3-bis(1-triethoxysilylcyclohexyl)urea |
|---|---|
| PubChem CID | 152523333 |
| Molecular Formula | C25H52N2O7Si2 |
| Molecular Weight | 548.87 g/mol |
| Exact Mass | 548.33 |
| IUPAC Name | 1,3-bis(1-triethoxysilylcyclohexyl)urea |
| SMILES | CCO[Si](OCC)(OCC)C1(NC(=O)NC2([Si](OCC)(OCC)OCC)CCCCC2)CCCCC1 |
| InChI | InChI=1S/C25H52N2O7Si2/c1-7-29-35(30-8-2,31-9-3)24(19-15-13-16-20-24)26-23(28)27-25(21-17-14-18-22-25)36(32-10-4,33-11-5)34-12-6/h7-22H2,1-6H3,(H2,26,27,28) |
| InChIKey | YHZORDPNSYTNAG-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 96.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.87 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|