About 1-ethyl-4-methoxy-3,6-dihydro-2H-pyridine
1-ethyl-4-methoxy-3,6-dihydro-2H-pyridine (PubChem CID 152524993) has the molecular formula C8H15NO
and a molecular weight of 141.21 g/mol. Its IUPAC name is 1-ethyl-4-methoxy-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 1-ethyl-4-methoxy-3,6-dihydro-2H-pyridine |
| PubChem CID | 152524993 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | 1-ethyl-4-methoxy-3,6-dihydro-2H-pyridine |
| SMILES | CCN1CC=C(OC)CC1 |
| InChI | InChI=1S/C8H15NO/c1-3-9-6-4-8(10-2)5-7-9/h4H,3,5-7H2,1-2H3 |
| InChIKey | YIHZKKUOTOHLTQ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-ethyl-4-methoxy-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4-methoxy-3,6-dihydro-2H-pyridine?
The IUPAC name of 1-ethyl-4-methoxy-3,6-dihydro-2H-pyridine (CID 152524993) is 1-ethyl-4-methoxy-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 1-ethyl-4-methoxy-3,6-dihydro-2H-pyridine?
The canonical SMILES for 1-ethyl-4-methoxy-3,6-dihydro-2H-pyridine is CCN1CC=C(OC)CC1.
What is the InChIKey of 1-ethyl-4-methoxy-3,6-dihydro-2H-pyridine?
The InChIKey is YIHZKKUOTOHLTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO/c1-3-9-6-4-8(10-2)5-7-9/h4H,3,5-7H2,1-2H3.
What are the key properties of 1-ethyl-4-methoxy-3,6-dihydro-2H-pyridine?
1-ethyl-4-methoxy-3,6-dihydro-2H-pyridine has a molecular weight of 141.21 g/mol, XLogP of 1.24, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4-methoxy-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 152524993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).