About (NE)-N-[2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethylidene]hydroxylamine
(NE)-N-[2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethylidene]hydroxylamine (PubChem CID 15252891) has the molecular formula C7H13NO3
and a molecular weight of 159.19 g/mol. Its IUPAC name is (NE)-N-[2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethylidene]hydroxylamine.
Molecular Properties
| Compound Name | (NE)-N-[2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethylidene]hydroxylamine |
| PubChem CID | 15252891 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | (NE)-N-[2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethylidene]hydroxylamine |
| SMILES | CC1(C)OC[C@H](C/C=N/O)O1 |
| InChI | InChI=1S/C7H13NO3/c1-7(2)10-5-6(11-7)3-4-8-9/h4,6,9H,3,5H2,1-2H3/b8-4+/t6-/m0/s1 |
| InChIKey | RSMAIBPPUNGKFS-VWOAIRDFSA-N |
| XLogP | 0.99 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NE)-N-[2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NE)-N-[2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethylidene]hydroxylamine?
The IUPAC name of (NE)-N-[2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethylidene]hydroxylamine (CID 15252891) is (NE)-N-[2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethylidene]hydroxylamine.
What is the SMILES notation for (NE)-N-[2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethylidene]hydroxylamine?
The canonical SMILES for (NE)-N-[2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethylidene]hydroxylamine is CC1(C)OC[C@H](C/C=N/O)O1.
What is the InChIKey of (NE)-N-[2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethylidene]hydroxylamine?
The InChIKey is RSMAIBPPUNGKFS-VWOAIRDFSA-N. The full InChI is InChI=1S/C7H13NO3/c1-7(2)10-5-6(11-7)3-4-8-9/h4,6,9H,3,5H2,1-2H3/b8-4+/t6-/m0/s1.
What are the key properties of (NE)-N-[2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethylidene]hydroxylamine?
(NE)-N-[2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethylidene]hydroxylamine has a molecular weight of 159.19 g/mol, XLogP of 0.99, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (NE)-N-[2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethylidene]hydroxylamine is sourced from PubChem (CID 15252891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).