C12H16N4O3 — CID 152531727
ethyl 3-amino-1-[(3S,4R)-4-cyanooxan-3-yl]pyrazole-4-carboxylate (PubChem CID 152531727) has the molecular formula C12H16N4O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is ethyl 3-amino-1-[(3S,4R)-4-cyanooxan-3-yl]pyrazole-4-carboxylate.
| Compound Name | ethyl 3-amino-1-[(3S,4R)-4-cyanooxan-3-yl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 152531727 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | ethyl 3-amino-1-[(3S,4R)-4-cyanooxan-3-yl]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn([C@@H]2COCC[C@H]2C#N)nc1N |
| InChI | InChI=1S/C12H16N4O3/c1-2-19-12(17)9-6-16(15-11(9)14)10-7-18-4-3-8(10)5-13/h6,8,10H,2-4,7H2,1H3,(H2,14,15)/t8-,10+/m0/s1 |
| InChIKey | YJQZZGHTOBTMTC-WCBMZHEXSA-N |
| XLogP | 0.74 |
| TPSA | 103.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |