C8H6O6 — CID 152533869
2-hydroxy-2-(5-hydroxypenta-1,3-diynyl)propanedioic acid (PubChem CID 152533869) has the molecular formula C8H6O6 and a molecular weight of 198.13 g/mol. Its IUPAC name is 2-hydroxy-2-(5-hydroxypenta-1,3-diynyl)propanedioic acid.
| Compound Name | 2-hydroxy-2-(5-hydroxypenta-1,3-diynyl)propanedioic acid |
|---|---|
| PubChem CID | 152533869 |
| Molecular Formula | C8H6O6 |
| Molecular Weight | 198.13 g/mol |
| Exact Mass | 198.02 |
| IUPAC Name | 2-hydroxy-2-(5-hydroxypenta-1,3-diynyl)propanedioic acid |
| SMILES | O=C(O)C(O)(C#CC#CCO)C(=O)O |
| InChI | InChI=1S/C8H6O6/c9-5-3-1-2-4-8(14,6(10)11)7(12)13/h9,14H,5H2,(H,10,11)(H,12,13) |
| InChIKey | YKCBFYKHOOVAGD-UHFFFAOYSA-N |
| XLogP | -2.11 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.13 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|