C11H20O2 — CID 15253536
(1R,2S)-1-cyclohexylpent-4-ene-1,2-diol (PubChem CID 15253536) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is (1R,2S)-1-cyclohexylpent-4-ene-1,2-diol.
| Compound Name | (1R,2S)-1-cyclohexylpent-4-ene-1,2-diol |
|---|---|
| PubChem CID | 15253536 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | (1R,2S)-1-cyclohexylpent-4-ene-1,2-diol |
| SMILES | C=CC[C@H](O)[C@H](O)C1CCCCC1 |
| InChI | InChI=1S/C11H20O2/c1-2-6-10(12)11(13)9-7-4-3-5-8-9/h2,9-13H,1,3-8H2/t10-,11+/m0/s1 |
| InChIKey | FQDSVSADXDLULF-WDEREUQCSA-N |
| XLogP | 1.86 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|