About 3,4-bis(2-chloro-3-pyridinyl)-2-oxido-1,2,5-oxadiazol-2-ium
3,4-bis(2-chloro-3-pyridinyl)-2-oxido-1,2,5-oxadiazol-2-ium (PubChem CID 15253698) has the molecular formula C12H6Cl2N4O2
and a molecular weight of 309.11 g/mol. Its IUPAC name is 3,4-bis(2-chloro-3-pyridinyl)-2-oxido-1,2,5-oxadiazol-2-ium.
Molecular Properties
| Compound Name | 3,4-bis(2-chloro-3-pyridinyl)-2-oxido-1,2,5-oxadiazol-2-ium |
| PubChem CID | 15253698 |
| Molecular Formula | C12H6Cl2N4O2 |
| Molecular Weight | 309.11 g/mol |
| Exact Mass | 307.99 |
| IUPAC Name | 3,4-bis(2-chloro-3-pyridinyl)-2-oxido-1,2,5-oxadiazol-2-ium |
| SMILES | [O-][n+]1onc(-c2cccnc2Cl)c1-c1cccnc1Cl |
| InChI | InChI=1S/C12H6Cl2N4O2/c13-11-7(3-1-5-15-11)9-10(18(19)20-17-9)8-4-2-6-16-12(8)14/h1-6H |
| InChIKey | ULFJFLRYPJMHNR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 78.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.11 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|
Analyze 3,4-bis(2-chloro-3-pyridinyl)-2-oxido-1,2,5-oxadiazol-2-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-bis(2-chloro-3-pyridinyl)-2-oxido-1,2,5-oxadiazol-2-ium?
The IUPAC name of 3,4-bis(2-chloro-3-pyridinyl)-2-oxido-1,2,5-oxadiazol-2-ium (CID 15253698) is 3,4-bis(2-chloro-3-pyridinyl)-2-oxido-1,2,5-oxadiazol-2-ium.
What is the SMILES notation for 3,4-bis(2-chloro-3-pyridinyl)-2-oxido-1,2,5-oxadiazol-2-ium?
The canonical SMILES for 3,4-bis(2-chloro-3-pyridinyl)-2-oxido-1,2,5-oxadiazol-2-ium is [O-][n+]1onc(-c2cccnc2Cl)c1-c1cccnc1Cl.
What is the InChIKey of 3,4-bis(2-chloro-3-pyridinyl)-2-oxido-1,2,5-oxadiazol-2-ium?
The InChIKey is ULFJFLRYPJMHNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6Cl2N4O2/c13-11-7(3-1-5-15-11)9-10(18(19)20-17-9)8-4-2-6-16-12(8)14/h1-6H.
What are the key properties of 3,4-bis(2-chloro-3-pyridinyl)-2-oxido-1,2,5-oxadiazol-2-ium?
3,4-bis(2-chloro-3-pyridinyl)-2-oxido-1,2,5-oxadiazol-2-ium has a molecular weight of 309.11 g/mol, XLogP of 2.74, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-bis(2-chloro-3-pyridinyl)-2-oxido-1,2,5-oxadiazol-2-ium is sourced from PubChem (CID 15253698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).