C13H13N3 — CID 152538187
7-benzyl-1,4-dihydropyrrolo[2,3-d]pyrimidine (PubChem CID 152538187) has the molecular formula C13H13N3 and a molecular weight of 211.27 g/mol. Its IUPAC name is 7-benzyl-1,4-dihydropyrrolo[2,3-d]pyrimidine.
| Compound Name | 7-benzyl-1,4-dihydropyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 152538187 |
| Molecular Formula | C13H13N3 |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 7-benzyl-1,4-dihydropyrrolo[2,3-d]pyrimidine |
| SMILES | C1=NCc2ccn(Cc3ccccc3)c2N1 |
| InChI | InChI=1S/C13H13N3/c1-2-4-11(5-3-1)9-16-7-6-12-8-14-10-15-13(12)16/h1-7,10H,8-9H2,(H,14,15) |
| InChIKey | YKYZRJJSSHZSEX-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 29.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |