About 2-[[3,5-dicyano-4-ethyl-6-(2H-pyridin-1-yl)-2-pyridinyl]sulfanyl]-2-phenylacetamide
2-[[3,5-dicyano-4-ethyl-6-(2H-pyridin-1-yl)-2-pyridinyl]sulfanyl]-2-phenylacetamide (PubChem CID 152538477) has the molecular formula C22H19N5OS
and a molecular weight of 401.50 g/mol. Its IUPAC name is 2-[[3,5-dicyano-4-ethyl-6-(2H-pyridin-1-yl)-2-pyridinyl]sulfanyl]-2-phenylacetamide.
Molecular Properties
| Compound Name | 2-[[3,5-dicyano-4-ethyl-6-(2H-pyridin-1-yl)-2-pyridinyl]sulfanyl]-2-phenylacetamide |
| PubChem CID | 152538477 |
| Molecular Formula | C22H19N5OS |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 2-[[3,5-dicyano-4-ethyl-6-(2H-pyridin-1-yl)-2-pyridinyl]sulfanyl]-2-phenylacetamide |
| SMILES | CCc1c(C#N)c(SC(C(N)=O)c2ccccc2)nc(N2C=CC=CC2)c1C#N |
| InChI | InChI=1S/C22H19N5OS/c1-2-16-17(13-23)21(27-11-7-4-8-12-27)26-22(18(16)14-24)29-19(20(25)28)15-9-5-3-6-10-15/h3-11,19H,2,12H2,1H3,(H2,25,28) |
| InChIKey | YLAKZXHRHRUIGR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 106.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[[3,5-dicyano-4-ethyl-6-(2H-pyridin-1-yl)-2-pyridinyl]sulfanyl]-2-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3,5-dicyano-4-ethyl-6-(2H-pyridin-1-yl)-2-pyridinyl]sulfanyl]-2-phenylacetamide?
The IUPAC name of 2-[[3,5-dicyano-4-ethyl-6-(2H-pyridin-1-yl)-2-pyridinyl]sulfanyl]-2-phenylacetamide (CID 152538477) is 2-[[3,5-dicyano-4-ethyl-6-(2H-pyridin-1-yl)-2-pyridinyl]sulfanyl]-2-phenylacetamide.
What is the SMILES notation for 2-[[3,5-dicyano-4-ethyl-6-(2H-pyridin-1-yl)-2-pyridinyl]sulfanyl]-2-phenylacetamide?
The canonical SMILES for 2-[[3,5-dicyano-4-ethyl-6-(2H-pyridin-1-yl)-2-pyridinyl]sulfanyl]-2-phenylacetamide is CCc1c(C#N)c(SC(C(N)=O)c2ccccc2)nc(N2C=CC=CC2)c1C#N.
What is the InChIKey of 2-[[3,5-dicyano-4-ethyl-6-(2H-pyridin-1-yl)-2-pyridinyl]sulfanyl]-2-phenylacetamide?
The InChIKey is YLAKZXHRHRUIGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19N5OS/c1-2-16-17(13-23)21(27-11-7-4-8-12-27)26-22(18(16)14-24)29-19(20(25)28)15-9-5-3-6-10-15/h3-11,19H,2,12H2,1H3,(H2,25,28).
What are the key properties of 2-[[3,5-dicyano-4-ethyl-6-(2H-pyridin-1-yl)-2-pyridinyl]sulfanyl]-2-phenylacetamide?
2-[[3,5-dicyano-4-ethyl-6-(2H-pyridin-1-yl)-2-pyridinyl]sulfanyl]-2-phenylacetamide has a molecular weight of 401.50 g/mol, XLogP of 3.60, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3,5-dicyano-4-ethyl-6-(2H-pyridin-1-yl)-2-pyridinyl]sulfanyl]-2-phenylacetamide is sourced from PubChem (CID 152538477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).