About 5-(2-methylpropyl)-1,3,5-dithiazinane
5-(2-methylpropyl)-1,3,5-dithiazinane (PubChem CID 15253874) has the molecular formula C7H15NS2
and a molecular weight of 177.34 g/mol. Its IUPAC name is 5-(2-methylpropyl)-1,3,5-dithiazinane.
Molecular Properties
| Compound Name | 5-(2-methylpropyl)-1,3,5-dithiazinane |
| PubChem CID | 15253874 |
| Molecular Formula | C7H15NS2 |
| Molecular Weight | 177.34 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | 5-(2-methylpropyl)-1,3,5-dithiazinane |
| SMILES | CC(C)CN1CSCSC1 |
| InChI | InChI=1S/C7H15NS2/c1-7(2)3-8-4-9-6-10-5-8/h7H,3-6H2,1-2H3 |
| InChIKey | SERDZSWRBRKKAS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(2-methylpropyl)-1,3,5-dithiazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-methylpropyl)-1,3,5-dithiazinane?
The IUPAC name of 5-(2-methylpropyl)-1,3,5-dithiazinane (CID 15253874) is 5-(2-methylpropyl)-1,3,5-dithiazinane.
What is the SMILES notation for 5-(2-methylpropyl)-1,3,5-dithiazinane?
The canonical SMILES for 5-(2-methylpropyl)-1,3,5-dithiazinane is CC(C)CN1CSCSC1.
What is the InChIKey of 5-(2-methylpropyl)-1,3,5-dithiazinane?
The InChIKey is SERDZSWRBRKKAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NS2/c1-7(2)3-8-4-9-6-10-5-8/h7H,3-6H2,1-2H3.
What are the key properties of 5-(2-methylpropyl)-1,3,5-dithiazinane?
5-(2-methylpropyl)-1,3,5-dithiazinane has a molecular weight of 177.34 g/mol, XLogP of 2.30, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-methylpropyl)-1,3,5-dithiazinane is sourced from PubChem (CID 15253874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).