C12H12F11I — CID 152540110
1-iodo-2-(1,1,1,2,3,3,4,4,5,5,5-undecafluoropentan-2-yl)cycloheptane (PubChem CID 152540110) has the molecular formula C12H12F11I and a molecular weight of 492.11 g/mol. Its IUPAC name is 1-iodo-2-(1,1,1,2,3,3,4,4,5,5,5-undecafluoropentan-2-yl)cycloheptane.
| Compound Name | 1-iodo-2-(1,1,1,2,3,3,4,4,5,5,5-undecafluoropentan-2-yl)cycloheptane |
|---|---|
| PubChem CID | 152540110 |
| Molecular Formula | C12H12F11I |
| Molecular Weight | 492.11 g/mol |
| Exact Mass | 491.98 |
| IUPAC Name | 1-iodo-2-(1,1,1,2,3,3,4,4,5,5,5-undecafluoropentan-2-yl)cycloheptane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(C1CCCCCC1I)C(F)(F)F |
| InChI | InChI=1S/C12H12F11I/c13-8(11(18,19)20,6-4-2-1-3-5-7(6)24)9(14,15)10(16,17)12(21,22)23/h6-7H,1-5H2 |
| InChIKey | YLJFRZLTUGQMKR-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.11 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|