C13H27O3PS — CID 15254083
4-di(propan-2-yloxy)phosphoryl-3,3-dimethyl-4-methylsulfanylbut-1-ene (PubChem CID 15254083) has the molecular formula C13H27O3PS and a molecular weight of 294.40 g/mol. Its IUPAC name is 4-di(propan-2-yloxy)phosphoryl-3,3-dimethyl-4-methylsulfanylbut-1-ene.
| Compound Name | 4-di(propan-2-yloxy)phosphoryl-3,3-dimethyl-4-methylsulfanylbut-1-ene |
|---|---|
| PubChem CID | 15254083 |
| Molecular Formula | C13H27O3PS |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 4-di(propan-2-yloxy)phosphoryl-3,3-dimethyl-4-methylsulfanylbut-1-ene |
| SMILES | C=CC(C)(C)C(SC)P(=O)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C13H27O3PS/c1-9-13(6,7)12(18-8)17(14,15-10(2)3)16-11(4)5/h9-12H,1H2,2-8H3 |
| InChIKey | QIRAKDCJLXDIKY-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|