About 1-[(2,4-dimethylphenyl)methoxymethyl]-2,4-dimethylbenzene
1-[(2,4-dimethylphenyl)methoxymethyl]-2,4-dimethylbenzene (PubChem CID 15254143) has the molecular formula C18H22O
and a molecular weight of 254.37 g/mol. Its IUPAC name is 1-[(2,4-dimethylphenyl)methoxymethyl]-2,4-dimethylbenzene.
Molecular Properties
| Compound Name | 1-[(2,4-dimethylphenyl)methoxymethyl]-2,4-dimethylbenzene |
| PubChem CID | 15254143 |
| Molecular Formula | C18H22O |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 1-[(2,4-dimethylphenyl)methoxymethyl]-2,4-dimethylbenzene |
| SMILES | Cc1ccc(COCc2ccc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C18H22O/c1-13-5-7-17(15(3)9-13)11-19-12-18-8-6-14(2)10-16(18)4/h5-10H,11-12H2,1-4H3 |
| InChIKey | LWOMITAZCBZKKN-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[(2,4-dimethylphenyl)methoxymethyl]-2,4-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,4-dimethylphenyl)methoxymethyl]-2,4-dimethylbenzene?
The IUPAC name of 1-[(2,4-dimethylphenyl)methoxymethyl]-2,4-dimethylbenzene (CID 15254143) is 1-[(2,4-dimethylphenyl)methoxymethyl]-2,4-dimethylbenzene.
What is the SMILES notation for 1-[(2,4-dimethylphenyl)methoxymethyl]-2,4-dimethylbenzene?
The canonical SMILES for 1-[(2,4-dimethylphenyl)methoxymethyl]-2,4-dimethylbenzene is Cc1ccc(COCc2ccc(C)cc2C)c(C)c1.
What is the InChIKey of 1-[(2,4-dimethylphenyl)methoxymethyl]-2,4-dimethylbenzene?
The InChIKey is LWOMITAZCBZKKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22O/c1-13-5-7-17(15(3)9-13)11-19-12-18-8-6-14(2)10-16(18)4/h5-10H,11-12H2,1-4H3.
What are the key properties of 1-[(2,4-dimethylphenyl)methoxymethyl]-2,4-dimethylbenzene?
1-[(2,4-dimethylphenyl)methoxymethyl]-2,4-dimethylbenzene has a molecular weight of 254.37 g/mol, XLogP of 4.64, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,4-dimethylphenyl)methoxymethyl]-2,4-dimethylbenzene is sourced from PubChem (CID 15254143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).