About 3,4-dinitrohexane
3,4-dinitrohexane (PubChem CID 15254205) has the molecular formula C6H12N2O4
and a molecular weight of 176.17 g/mol. Its IUPAC name is 3,4-dinitrohexane.
Molecular Properties
| Compound Name | 3,4-dinitrohexane |
| PubChem CID | 15254205 |
| Molecular Formula | C6H12N2O4 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 3,4-dinitrohexane |
| SMILES | CCC(C(CC)[N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C6H12N2O4/c1-3-5(7(9)10)6(4-2)8(11)12/h5-6H,3-4H2,1-2H3 |
| InChIKey | BQLWHDVPNRTGRM-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dinitrohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dinitrohexane?
The IUPAC name of 3,4-dinitrohexane (CID 15254205) is 3,4-dinitrohexane.
What is the SMILES notation for 3,4-dinitrohexane?
The canonical SMILES for 3,4-dinitrohexane is CCC(C(CC)[N+](=O)[O-])[N+](=O)[O-].
What is the InChIKey of 3,4-dinitrohexane?
The InChIKey is BQLWHDVPNRTGRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O4/c1-3-5(7(9)10)6(4-2)8(11)12/h5-6H,3-4H2,1-2H3.
What are the key properties of 3,4-dinitrohexane?
3,4-dinitrohexane has a molecular weight of 176.17 g/mol, XLogP of 1.10, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dinitrohexane is sourced from PubChem (CID 15254205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).