C10H14ClNO2 — CID 15254218
(3E,5Z)-6-chloro-6-morpholin-4-ylhexa-3,5-dien-2-one (PubChem CID 15254218) has the molecular formula C10H14ClNO2 and a molecular weight of 215.68 g/mol. Its IUPAC name is (3E,5Z)-6-chloro-6-morpholin-4-ylhexa-3,5-dien-2-one.
| Compound Name | (3E,5Z)-6-chloro-6-morpholin-4-ylhexa-3,5-dien-2-one |
|---|---|
| PubChem CID | 15254218 |
| Molecular Formula | C10H14ClNO2 |
| Molecular Weight | 215.68 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | (3E,5Z)-6-chloro-6-morpholin-4-ylhexa-3,5-dien-2-one |
| SMILES | CC(=O)/C=C/C=C(\Cl)N1CCOCC1 |
| InChI | InChI=1S/C10H14ClNO2/c1-9(13)3-2-4-10(11)12-5-7-14-8-6-12/h2-4H,5-8H2,1H3/b3-2+,10-4+ |
| InChIKey | GTZBKASOBCJMFL-KHVHPYDTSA-N |
| XLogP | 1.54 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.68 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|