C14H30O3 — CID 152544826
4-(methoxymethoxymethyl)-4-(methoxymethyl)-2,6-dimethylheptane (PubChem CID 152544826) has the molecular formula C14H30O3 and a molecular weight of 246.39 g/mol. Its IUPAC name is 4-(methoxymethoxymethyl)-4-(methoxymethyl)-2,6-dimethylheptane.
| Compound Name | 4-(methoxymethoxymethyl)-4-(methoxymethyl)-2,6-dimethylheptane |
|---|---|
| PubChem CID | 152544826 |
| Molecular Formula | C14H30O3 |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.22 |
| IUPAC Name | 4-(methoxymethoxymethyl)-4-(methoxymethyl)-2,6-dimethylheptane |
| SMILES | COCOCC(COC)(CC(C)C)CC(C)C |
| InChI | InChI=1S/C14H30O3/c1-12(2)7-14(9-15-5,8-13(3)4)10-17-11-16-6/h12-13H,7-11H2,1-6H3 |
| InChIKey | YMGLSXYMMQHHAE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|