About 4-(1-adamantyl)-3,5-ditert-butylbenzene-1,2-diol
4-(1-adamantyl)-3,5-ditert-butylbenzene-1,2-diol (PubChem CID 152547156) has the molecular formula C24H36O2
and a molecular weight of 356.55 g/mol. Its IUPAC name is 4-(1-adamantyl)-3,5-ditert-butylbenzene-1,2-diol.
Molecular Properties
| Compound Name | 4-(1-adamantyl)-3,5-ditert-butylbenzene-1,2-diol |
| PubChem CID | 152547156 |
| Molecular Formula | C24H36O2 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | 4-(1-adamantyl)-3,5-ditert-butylbenzene-1,2-diol |
| SMILES | CC(C)(C)c1cc(O)c(O)c(C(C)(C)C)c1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H36O2/c1-22(2,3)17-10-18(25)21(26)20(23(4,5)6)19(17)24-11-14-7-15(12-24)9-16(8-14)13-24/h10,14-16,25-26H,7-9,11-13H2,1-6H3 |
| InChIKey | YMSMBFIIABWAGN-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 4-(1-adamantyl)-3,5-ditert-butylbenzene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-adamantyl)-3,5-ditert-butylbenzene-1,2-diol?
The IUPAC name of 4-(1-adamantyl)-3,5-ditert-butylbenzene-1,2-diol (CID 152547156) is 4-(1-adamantyl)-3,5-ditert-butylbenzene-1,2-diol.
What is the SMILES notation for 4-(1-adamantyl)-3,5-ditert-butylbenzene-1,2-diol?
The canonical SMILES for 4-(1-adamantyl)-3,5-ditert-butylbenzene-1,2-diol is CC(C)(C)c1cc(O)c(O)c(C(C)(C)C)c1C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 4-(1-adamantyl)-3,5-ditert-butylbenzene-1,2-diol?
The InChIKey is YMSMBFIIABWAGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H36O2/c1-22(2,3)17-10-18(25)21(26)20(23(4,5)6)19(17)24-11-14-7-15(12-24)9-16(8-14)13-24/h10,14-16,25-26H,7-9,11-13H2,1-6H3.
What are the key properties of 4-(1-adamantyl)-3,5-ditert-butylbenzene-1,2-diol?
4-(1-adamantyl)-3,5-ditert-butylbenzene-1,2-diol has a molecular weight of 356.55 g/mol, XLogP of 6.16, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-adamantyl)-3,5-ditert-butylbenzene-1,2-diol is sourced from PubChem (CID 152547156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).