C17H30O5 — CID 15254807
ethyl 9-(2,2-dimethylpropanoyloxy)-6-hydroxy-2-methylidenenonanoate (PubChem CID 15254807) has the molecular formula C17H30O5 and a molecular weight of 314.42 g/mol. Its IUPAC name is ethyl 9-(2,2-dimethylpropanoyloxy)-6-hydroxy-2-methylidenenonanoate.
| Compound Name | ethyl 9-(2,2-dimethylpropanoyloxy)-6-hydroxy-2-methylidenenonanoate |
|---|---|
| PubChem CID | 15254807 |
| Molecular Formula | C17H30O5 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | ethyl 9-(2,2-dimethylpropanoyloxy)-6-hydroxy-2-methylidenenonanoate |
| SMILES | C=C(CCCC(O)CCCOC(=O)C(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C17H30O5/c1-6-21-15(19)13(2)9-7-10-14(18)11-8-12-22-16(20)17(3,4)5/h14,18H,2,6-12H2,1,3-5H3 |
| InChIKey | VUPXOKCNTJSIGC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|