C10H11F3O4 — CID 15254827
methyl (1S,5S)-5-(2,2,2-trifluoroacetyl)oxycyclohex-3-ene-1-carboxylate (PubChem CID 15254827) has the molecular formula C10H11F3O4 and a molecular weight of 252.19 g/mol. Its IUPAC name is methyl (1S,5S)-5-(2,2,2-trifluoroacetyl)oxycyclohex-3-ene-1-carboxylate.
| Compound Name | methyl (1S,5S)-5-(2,2,2-trifluoroacetyl)oxycyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 15254827 |
| Molecular Formula | C10H11F3O4 |
| Molecular Weight | 252.19 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | methyl (1S,5S)-5-(2,2,2-trifluoroacetyl)oxycyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)[C@H]1CC=C[C@@H](OC(=O)C(F)(F)F)C1 |
| InChI | InChI=1S/C10H11F3O4/c1-16-8(14)6-3-2-4-7(5-6)17-9(15)10(11,12)13/h2,4,6-7H,3,5H2,1H3/t6-,7+/m0/s1 |
| InChIKey | QPXWVVXBHZTGJU-NKWVEPMBSA-N |
| XLogP | 1.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.19 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|