C12H5F15N2O2 — CID 152551011
6-methyl-5-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)-1H-pyrimidine-2,4-dione (PubChem CID 152551011) has the molecular formula C12H5F15N2O2 and a molecular weight of 494.15 g/mol. Its IUPAC name is 6-methyl-5-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 6-methyl-5-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 152551011 |
| Molecular Formula | C12H5F15N2O2 |
| Molecular Weight | 494.15 g/mol |
| Exact Mass | 494.01 |
| IUPAC Name | 6-methyl-5-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)-1H-pyrimidine-2,4-dione |
| SMILES | Cc1[nH]c(=O)[nH]c(=O)c1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H5F15N2O2/c1-2-3(4(30)29-5(31)28-2)6(13,14)7(15,16)8(17,18)9(19,20)10(21,22)11(23,24)12(25,26)27/h1H3,(H2,28,29,30,31) |
| InChIKey | YNMHJNXJHAKFPN-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.15 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|