About 1-bromo-N-cyclohexyl-3,3-dimethylbutan-2-imine
1-bromo-N-cyclohexyl-3,3-dimethylbutan-2-imine (PubChem CID 15255273) has the molecular formula C12H22BrN
and a molecular weight of 260.22 g/mol. Its IUPAC name is 1-bromo-N-cyclohexyl-3,3-dimethylbutan-2-imine.
Molecular Properties
| Compound Name | 1-bromo-N-cyclohexyl-3,3-dimethylbutan-2-imine |
| PubChem CID | 15255273 |
| Molecular Formula | C12H22BrN |
| Molecular Weight | 260.22 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 1-bromo-N-cyclohexyl-3,3-dimethylbutan-2-imine |
| SMILES | CC(C)(C)/C(CBr)=N/C1CCCCC1 |
| InChI | InChI=1S/C12H22BrN/c1-12(2,3)11(9-13)14-10-7-5-4-6-8-10/h10H,4-9H2,1-3H3/b14-11+ |
| InChIKey | BMHVFCPNVBJKHY-SDNWHVSQSA-N |
| XLogP | 4.20 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.22 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-N-cyclohexyl-3,3-dimethylbutan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-N-cyclohexyl-3,3-dimethylbutan-2-imine?
The IUPAC name of 1-bromo-N-cyclohexyl-3,3-dimethylbutan-2-imine (CID 15255273) is 1-bromo-N-cyclohexyl-3,3-dimethylbutan-2-imine.
What is the SMILES notation for 1-bromo-N-cyclohexyl-3,3-dimethylbutan-2-imine?
The canonical SMILES for 1-bromo-N-cyclohexyl-3,3-dimethylbutan-2-imine is CC(C)(C)/C(CBr)=N/C1CCCCC1.
What is the InChIKey of 1-bromo-N-cyclohexyl-3,3-dimethylbutan-2-imine?
The InChIKey is BMHVFCPNVBJKHY-SDNWHVSQSA-N. The full InChI is InChI=1S/C12H22BrN/c1-12(2,3)11(9-13)14-10-7-5-4-6-8-10/h10H,4-9H2,1-3H3/b14-11+.
What are the key properties of 1-bromo-N-cyclohexyl-3,3-dimethylbutan-2-imine?
1-bromo-N-cyclohexyl-3,3-dimethylbutan-2-imine has a molecular weight of 260.22 g/mol, XLogP of 4.20, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-N-cyclohexyl-3,3-dimethylbutan-2-imine is sourced from PubChem (CID 15255273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).