About 2-oxo-2-[3,4,6-trichloro-2-(3-cyclopropyl-3-methylbutoxy)carbonylphenoxy]acetic acid
2-oxo-2-[3,4,6-trichloro-2-(3-cyclopropyl-3-methylbutoxy)carbonylphenoxy]acetic acid (PubChem CID 152554579) has the molecular formula C17H17Cl3O6
and a molecular weight of 423.68 g/mol. Its IUPAC name is 2-oxo-2-[3,4,6-trichloro-2-(3-cyclopropyl-3-methylbutoxy)carbonylphenoxy]acetic acid.
Molecular Properties
| Compound Name | 2-oxo-2-[3,4,6-trichloro-2-(3-cyclopropyl-3-methylbutoxy)carbonylphenoxy]acetic acid |
| PubChem CID | 152554579 |
| Molecular Formula | C17H17Cl3O6 |
| Molecular Weight | 423.68 g/mol |
| Exact Mass | 422.01 |
| IUPAC Name | 2-oxo-2-[3,4,6-trichloro-2-(3-cyclopropyl-3-methylbutoxy)carbonylphenoxy]acetic acid |
| SMILES | CC(C)(CCOC(=O)c1c(Cl)c(Cl)cc(Cl)c1OC(=O)C(=O)O)C1CC1 |
| InChI | InChI=1S/C17H17Cl3O6/c1-17(2,8-3-4-8)5-6-25-15(23)11-12(20)9(18)7-10(19)13(11)26-16(24)14(21)22/h7-8H,3-6H2,1-2H3,(H,21,22) |
| InChIKey | YOEVTXUIYOLMRD-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.68 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 2-oxo-2-[3,4,6-trichloro-2-(3-cyclopropyl-3-methylbutoxy)carbonylphenoxy]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-2-[3,4,6-trichloro-2-(3-cyclopropyl-3-methylbutoxy)carbonylphenoxy]acetic acid?
The IUPAC name of 2-oxo-2-[3,4,6-trichloro-2-(3-cyclopropyl-3-methylbutoxy)carbonylphenoxy]acetic acid (CID 152554579) is 2-oxo-2-[3,4,6-trichloro-2-(3-cyclopropyl-3-methylbutoxy)carbonylphenoxy]acetic acid.
What is the SMILES notation for 2-oxo-2-[3,4,6-trichloro-2-(3-cyclopropyl-3-methylbutoxy)carbonylphenoxy]acetic acid?
The canonical SMILES for 2-oxo-2-[3,4,6-trichloro-2-(3-cyclopropyl-3-methylbutoxy)carbonylphenoxy]acetic acid is CC(C)(CCOC(=O)c1c(Cl)c(Cl)cc(Cl)c1OC(=O)C(=O)O)C1CC1.
What is the InChIKey of 2-oxo-2-[3,4,6-trichloro-2-(3-cyclopropyl-3-methylbutoxy)carbonylphenoxy]acetic acid?
The InChIKey is YOEVTXUIYOLMRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17Cl3O6/c1-17(2,8-3-4-8)5-6-25-15(23)11-12(20)9(18)7-10(19)13(11)26-16(24)14(21)22/h7-8H,3-6H2,1-2H3,(H,21,22).
What are the key properties of 2-oxo-2-[3,4,6-trichloro-2-(3-cyclopropyl-3-methylbutoxy)carbonylphenoxy]acetic acid?
2-oxo-2-[3,4,6-trichloro-2-(3-cyclopropyl-3-methylbutoxy)carbonylphenoxy]acetic acid has a molecular weight of 423.68 g/mol, XLogP of 4.62, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-2-[3,4,6-trichloro-2-(3-cyclopropyl-3-methylbutoxy)carbonylphenoxy]acetic acid is sourced from PubChem (CID 152554579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).