C14H28S4Si2 — CID 15255488
8,8,15,15-tetramethyl-1,5,10,14-tetrathia-8,15-disiladispiro[5.2.59.26]hexadecane (PubChem CID 15255488) has the molecular formula C14H28S4Si2 and a molecular weight of 380.82 g/mol. Its IUPAC name is 8,8,15,15-tetramethyl-1,5,10,14-tetrathia-8,15-disiladispiro[5.2.59.26]hexadecane.
| Compound Name | 8,8,15,15-tetramethyl-1,5,10,14-tetrathia-8,15-disiladispiro[5.2.59.26]hexadecane |
|---|---|
| PubChem CID | 15255488 |
| Molecular Formula | C14H28S4Si2 |
| Molecular Weight | 380.82 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | 8,8,15,15-tetramethyl-1,5,10,14-tetrathia-8,15-disiladispiro[5.2.59.26]hexadecane |
| SMILES | C[Si]1(C)CC2(C[Si](C)(C)C13SCCCS3)SCCCS2 |
| InChI | InChI=1S/C14H28S4Si2/c1-19(2)11-13(15-7-5-8-16-13)12-20(3,4)14(19)17-9-6-10-18-14/h5-12H2,1-4H3 |
| InChIKey | SXPYWGXXIMPTSR-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.82 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|