About 1-cyclopropyl-2-[(2,3-difluorophenyl)methyl]-3-imidazol-1-ylpropan-2-ol
1-cyclopropyl-2-[(2,3-difluorophenyl)methyl]-3-imidazol-1-ylpropan-2-ol (PubChem CID 152554917) has the molecular formula C16H18F2N2O
and a molecular weight of 292.33 g/mol. Its IUPAC name is 1-cyclopropyl-2-[(2,3-difluorophenyl)methyl]-3-imidazol-1-ylpropan-2-ol.
Molecular Properties
| Compound Name | 1-cyclopropyl-2-[(2,3-difluorophenyl)methyl]-3-imidazol-1-ylpropan-2-ol |
| PubChem CID | 152554917 |
| Molecular Formula | C16H18F2N2O |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 1-cyclopropyl-2-[(2,3-difluorophenyl)methyl]-3-imidazol-1-ylpropan-2-ol |
| SMILES | OC(Cc1cccc(F)c1F)(CC1CC1)Cn1ccnc1 |
| InChI | InChI=1S/C16H18F2N2O/c17-14-3-1-2-13(15(14)18)9-16(21,8-12-4-5-12)10-20-7-6-19-11-20/h1-3,6-7,11-12,21H,4-5,8-10H2 |
| InChIKey | YOGUDRSQHJMWJV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-cyclopropyl-2-[(2,3-difluorophenyl)methyl]-3-imidazol-1-ylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-2-[(2,3-difluorophenyl)methyl]-3-imidazol-1-ylpropan-2-ol?
The IUPAC name of 1-cyclopropyl-2-[(2,3-difluorophenyl)methyl]-3-imidazol-1-ylpropan-2-ol (CID 152554917) is 1-cyclopropyl-2-[(2,3-difluorophenyl)methyl]-3-imidazol-1-ylpropan-2-ol.
What is the SMILES notation for 1-cyclopropyl-2-[(2,3-difluorophenyl)methyl]-3-imidazol-1-ylpropan-2-ol?
The canonical SMILES for 1-cyclopropyl-2-[(2,3-difluorophenyl)methyl]-3-imidazol-1-ylpropan-2-ol is OC(Cc1cccc(F)c1F)(CC1CC1)Cn1ccnc1.
What is the InChIKey of 1-cyclopropyl-2-[(2,3-difluorophenyl)methyl]-3-imidazol-1-ylpropan-2-ol?
The InChIKey is YOGUDRSQHJMWJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18F2N2O/c17-14-3-1-2-13(15(14)18)9-16(21,8-12-4-5-12)10-20-7-6-19-11-20/h1-3,6-7,11-12,21H,4-5,8-10H2.
What are the key properties of 1-cyclopropyl-2-[(2,3-difluorophenyl)methyl]-3-imidazol-1-ylpropan-2-ol?
1-cyclopropyl-2-[(2,3-difluorophenyl)methyl]-3-imidazol-1-ylpropan-2-ol has a molecular weight of 292.33 g/mol, XLogP of 2.94, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-2-[(2,3-difluorophenyl)methyl]-3-imidazol-1-ylpropan-2-ol is sourced from PubChem (CID 152554917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).