About methyl 5-bromo-6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)pyridine-3-carboxylate
methyl 5-bromo-6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)pyridine-3-carboxylate (PubChem CID 152558375) has the molecular formula C12H11BrF2N2O2
and a molecular weight of 333.13 g/mol. Its IUPAC name is methyl 5-bromo-6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)pyridine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 5-bromo-6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)pyridine-3-carboxylate |
| PubChem CID | 152558375 |
| Molecular Formula | C12H11BrF2N2O2 |
| Molecular Weight | 333.13 g/mol |
| Exact Mass | 332.00 |
| IUPAC Name | methyl 5-bromo-6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)pyridine-3-carboxylate |
| SMILES | COC(=O)c1cnc(N2CC3C(C2)C3(F)F)c(Br)c1 |
| InChI | InChI=1S/C12H11BrF2N2O2/c1-19-11(18)6-2-9(13)10(16-3-6)17-4-7-8(5-17)12(7,14)15/h2-3,7-8H,4-5H2,1H3 |
| InChIKey | YOYSRVUPMYQFOX-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.13 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 5-bromo-6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-bromo-6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)pyridine-3-carboxylate?
The IUPAC name of methyl 5-bromo-6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)pyridine-3-carboxylate (CID 152558375) is methyl 5-bromo-6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)pyridine-3-carboxylate.
What is the SMILES notation for methyl 5-bromo-6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)pyridine-3-carboxylate?
The canonical SMILES for methyl 5-bromo-6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)pyridine-3-carboxylate is COC(=O)c1cnc(N2CC3C(C2)C3(F)F)c(Br)c1.
What is the InChIKey of methyl 5-bromo-6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)pyridine-3-carboxylate?
The InChIKey is YOYSRVUPMYQFOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11BrF2N2O2/c1-19-11(18)6-2-9(13)10(16-3-6)17-4-7-8(5-17)12(7,14)15/h2-3,7-8H,4-5H2,1H3.
What are the key properties of methyl 5-bromo-6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)pyridine-3-carboxylate?
methyl 5-bromo-6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)pyridine-3-carboxylate has a molecular weight of 333.13 g/mol, XLogP of 2.33, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-bromo-6-(6,6-difluoro-3-azabicyclo[3.1.0]hexan-3-yl)pyridine-3-carboxylate is sourced from PubChem (CID 152558375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).