C13H10O3 — CID 15256012
2-ethoxy-4,4,5,5-tetraethynyl-1,3-dioxolane (PubChem CID 15256012) has the molecular formula C13H10O3 and a molecular weight of 214.22 g/mol. Its IUPAC name is 2-ethoxy-4,4,5,5-tetraethynyl-1,3-dioxolane.
| Compound Name | 2-ethoxy-4,4,5,5-tetraethynyl-1,3-dioxolane |
|---|---|
| PubChem CID | 15256012 |
| Molecular Formula | C13H10O3 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 2-ethoxy-4,4,5,5-tetraethynyl-1,3-dioxolane |
| SMILES | C#CC1(C#C)OC(OCC)OC1(C#C)C#C |
| InChI | InChI=1S/C13H10O3/c1-6-12(7-2)13(8-3,9-4)16-11(15-12)14-10-5/h1-4,11H,10H2,5H3 |
| InChIKey | OXHNAPFKKNWRCU-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|