C27H38FN3O5SSi — CID 152560853
[3-[7-(2,2-dimethylpropanoyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]phenyl] 1-fluorobutane-1-sulfonate (PubChem CID 152560853) has the molecular formula C27H38FN3O5SSi and a molecular weight of 563.77 g/mol. Its IUPAC name is [3-[7-(2,2-dimethylpropanoyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]phenyl] 1-fluorobutane-1-sulfonate.
| Compound Name | [3-[7-(2,2-dimethylpropanoyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]phenyl] 1-fluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 152560853 |
| Molecular Formula | C27H38FN3O5SSi |
| Molecular Weight | 563.77 g/mol |
| Exact Mass | 563.23 |
| IUPAC Name | [3-[7-(2,2-dimethylpropanoyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]phenyl] 1-fluorobutane-1-sulfonate |
| SMILES | CCCC(F)S(=O)(=O)Oc1cccc(-c2cnc3c(n2)c(C(=O)C(C)(C)C)cn3COCC[Si](C)(C)C)c1 |
| InChI | InChI=1S/C27H38FN3O5SSi/c1-8-10-23(28)37(33,34)36-20-12-9-11-19(15-20)22-16-29-26-24(30-22)21(25(32)27(2,3)4)17-31(26)18-35-13-14-38(5,6)7/h9,11-12,15-17,23H,8,10,13-14,18H2,1-7H3 |
| InChIKey | YPLSIEZSAMMYKW-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 100.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.77 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|