About quinolin-2-yl (NZ)-N-[2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]carbamate
quinolin-2-yl (NZ)-N-[2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]carbamate (PubChem CID 15256436) has the molecular formula C19H13F3N2O2
and a molecular weight of 358.32 g/mol. Its IUPAC name is quinolin-2-yl (NZ)-N-[2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]carbamate.
Molecular Properties
| Compound Name | quinolin-2-yl (NZ)-N-[2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]carbamate |
| PubChem CID | 15256436 |
| Molecular Formula | C19H13F3N2O2 |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | quinolin-2-yl (NZ)-N-[2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]carbamate |
| SMILES | Cc1ccc(/C(=N/C(=O)Oc2ccc3ccccc3n2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H13F3N2O2/c1-12-6-8-14(9-7-12)17(19(20,21)22)24-18(25)26-16-11-10-13-4-2-3-5-15(13)23-16/h2-11H,1H3/b24-17- |
| InChIKey | VZTMDAVDUWQLEI-ULJHMMPZSA-N |
| XLogP | 5.09 |
| TPSA | 51.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze quinolin-2-yl (NZ)-N-[2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolin-2-yl (NZ)-N-[2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]carbamate?
The IUPAC name of quinolin-2-yl (NZ)-N-[2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]carbamate (CID 15256436) is quinolin-2-yl (NZ)-N-[2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]carbamate.
What is the SMILES notation for quinolin-2-yl (NZ)-N-[2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]carbamate?
The canonical SMILES for quinolin-2-yl (NZ)-N-[2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]carbamate is Cc1ccc(/C(=N/C(=O)Oc2ccc3ccccc3n2)C(F)(F)F)cc1.
What is the InChIKey of quinolin-2-yl (NZ)-N-[2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]carbamate?
The InChIKey is VZTMDAVDUWQLEI-ULJHMMPZSA-N. The full InChI is InChI=1S/C19H13F3N2O2/c1-12-6-8-14(9-7-12)17(19(20,21)22)24-18(25)26-16-11-10-13-4-2-3-5-15(13)23-16/h2-11H,1H3/b24-17-.
What are the key properties of quinolin-2-yl (NZ)-N-[2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]carbamate?
quinolin-2-yl (NZ)-N-[2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]carbamate has a molecular weight of 358.32 g/mol, XLogP of 5.09, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for quinolin-2-yl (NZ)-N-[2,2,2-trifluoro-1-(4-methylphenyl)ethylidene]carbamate is sourced from PubChem (CID 15256436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).