About [(1-methoxy-1-oxopent-4-en-2-yl)amino] piperidine-1-carboxylate
[(1-methoxy-1-oxopent-4-en-2-yl)amino] piperidine-1-carboxylate (PubChem CID 152569836) has the molecular formula C12H20N2O4
and a molecular weight of 256.30 g/mol. Its IUPAC name is [(1-methoxy-1-oxopent-4-en-2-yl)amino] piperidine-1-carboxylate.
Molecular Properties
| Compound Name | [(1-methoxy-1-oxopent-4-en-2-yl)amino] piperidine-1-carboxylate |
| PubChem CID | 152569836 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | [(1-methoxy-1-oxopent-4-en-2-yl)amino] piperidine-1-carboxylate |
| SMILES | C=CCC(NOC(=O)N1CCCCC1)C(=O)OC |
| InChI | InChI=1S/C12H20N2O4/c1-3-7-10(11(15)17-2)13-18-12(16)14-8-5-4-6-9-14/h3,10,13H,1,4-9H2,2H3 |
| InChIKey | YRGCIAVKKWEVSY-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(1-methoxy-1-oxopent-4-en-2-yl)amino] piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1-methoxy-1-oxopent-4-en-2-yl)amino] piperidine-1-carboxylate?
The IUPAC name of [(1-methoxy-1-oxopent-4-en-2-yl)amino] piperidine-1-carboxylate (CID 152569836) is [(1-methoxy-1-oxopent-4-en-2-yl)amino] piperidine-1-carboxylate.
What is the SMILES notation for [(1-methoxy-1-oxopent-4-en-2-yl)amino] piperidine-1-carboxylate?
The canonical SMILES for [(1-methoxy-1-oxopent-4-en-2-yl)amino] piperidine-1-carboxylate is C=CCC(NOC(=O)N1CCCCC1)C(=O)OC.
What is the InChIKey of [(1-methoxy-1-oxopent-4-en-2-yl)amino] piperidine-1-carboxylate?
The InChIKey is YRGCIAVKKWEVSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O4/c1-3-7-10(11(15)17-2)13-18-12(16)14-8-5-4-6-9-14/h3,10,13H,1,4-9H2,2H3.
What are the key properties of [(1-methoxy-1-oxopent-4-en-2-yl)amino] piperidine-1-carboxylate?
[(1-methoxy-1-oxopent-4-en-2-yl)amino] piperidine-1-carboxylate has a molecular weight of 256.30 g/mol, XLogP of 1.23, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1-methoxy-1-oxopent-4-en-2-yl)amino] piperidine-1-carboxylate is sourced from PubChem (CID 152569836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).