C21H23F2N3O4 — CID 152570248
[2-[1-[4-[2-(2,2-difluoroethoxy)ethyl]-3-methylphenyl]ethyl]-1-oxo-3H-pyrrolo[3,4-c]pyridin-4-yl]carbamic acid (PubChem CID 152570248) has the molecular formula C21H23F2N3O4 and a molecular weight of 419.43 g/mol. Its IUPAC name is [2-[1-[4-[2-(2,2-difluoroethoxy)ethyl]-3-methylphenyl]ethyl]-1-oxo-3H-pyrrolo[3,4-c]pyridin-4-yl]carbamic acid.
| Compound Name | [2-[1-[4-[2-(2,2-difluoroethoxy)ethyl]-3-methylphenyl]ethyl]-1-oxo-3H-pyrrolo[3,4-c]pyridin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 152570248 |
| Molecular Formula | C21H23F2N3O4 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | [2-[1-[4-[2-(2,2-difluoroethoxy)ethyl]-3-methylphenyl]ethyl]-1-oxo-3H-pyrrolo[3,4-c]pyridin-4-yl]carbamic acid |
| SMILES | Cc1cc(C(C)N2Cc3c(ccnc3NC(=O)O)C2=O)ccc1CCOCC(F)F |
| InChI | InChI=1S/C21H23F2N3O4/c1-12-9-15(4-3-14(12)6-8-30-11-18(22)23)13(2)26-10-17-16(20(26)27)5-7-24-19(17)25-21(28)29/h3-5,7,9,13,18H,6,8,10-11H2,1-2H3,(H,24,25)(H,28,29) |
| InChIKey | YRIHEHTVHJAIMI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|