C21H24OS — CID 15257347
(3R,4S)-4-tert-butylsulfanyl-1,5-diphenylpent-1-yn-3-ol (PubChem CID 15257347) has the molecular formula C21H24OS and a molecular weight of 324.49 g/mol. Its IUPAC name is (3R,4S)-4-tert-butylsulfanyl-1,5-diphenylpent-1-yn-3-ol.
| Compound Name | (3R,4S)-4-tert-butylsulfanyl-1,5-diphenylpent-1-yn-3-ol |
|---|---|
| PubChem CID | 15257347 |
| Molecular Formula | C21H24OS |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | (3R,4S)-4-tert-butylsulfanyl-1,5-diphenylpent-1-yn-3-ol |
| SMILES | CC(C)(C)S[C@@H](Cc1ccccc1)[C@H](O)C#Cc1ccccc1 |
| InChI | InChI=1S/C21H24OS/c1-21(2,3)23-20(16-18-12-8-5-9-13-18)19(22)15-14-17-10-6-4-7-11-17/h4-13,19-20,22H,16H2,1-3H3/t19-,20+/m1/s1 |
| InChIKey | CJXQOZFGKQVIEO-UXHICEINSA-N |
| XLogP | 4.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|