C26H37N5O5Si — CID 152573786
N-[3-[4-(methoxymethyl)-6-[(3R)-3-methoxyoxolan-3-yl]-2-pyridinyl]-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-c]pyridin-5-yl]acetamide (PubChem CID 152573786) has the molecular formula C26H37N5O5Si and a molecular weight of 527.70 g/mol. Its IUPAC name is N-[3-[4-(methoxymethyl)-6-[(3R)-3-methoxyoxolan-3-yl]-2-pyridinyl]-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-c]pyridin-5-yl]acetamide.
| Compound Name | N-[3-[4-(methoxymethyl)-6-[(3R)-3-methoxyoxolan-3-yl]-2-pyridinyl]-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-c]pyridin-5-yl]acetamide |
|---|---|
| PubChem CID | 152573786 |
| Molecular Formula | C26H37N5O5Si |
| Molecular Weight | 527.70 g/mol |
| Exact Mass | 527.26 |
| IUPAC Name | N-[3-[4-(methoxymethyl)-6-[(3R)-3-methoxyoxolan-3-yl]-2-pyridinyl]-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-c]pyridin-5-yl]acetamide |
| SMILES | COCc1cc(-c2nn(COCC[Si](C)(C)C)c3cnc(NC(C)=O)cc23)nc([C@]2(OC)CCOC2)c1 |
| InChI | InChI=1S/C26H37N5O5Si/c1-18(32)28-24-13-20-22(14-27-24)31(17-36-9-10-37(4,5)6)30-25(20)21-11-19(15-33-2)12-23(29-21)26(34-3)7-8-35-16-26/h11-14H,7-10,15-17H2,1-6H3,(H,27,28,32)/t26-/m0/s1 |
| InChIKey | YSAVYMYJEBMHCH-SANMLTNESA-N |
| XLogP | 4.17 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.70 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|