C18H20N2O — CID 15257616
4-tert-butyl-3,5-diphenyl-5H-1,2,4-oxadiazole (PubChem CID 15257616) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is 4-tert-butyl-3,5-diphenyl-5H-1,2,4-oxadiazole.
| Compound Name | 4-tert-butyl-3,5-diphenyl-5H-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 15257616 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 4-tert-butyl-3,5-diphenyl-5H-1,2,4-oxadiazole |
| SMILES | CC(C)(C)N1C(c2ccccc2)=NOC1c1ccccc1 |
| InChI | InChI=1S/C18H20N2O/c1-18(2,3)20-16(14-10-6-4-7-11-14)19-21-17(20)15-12-8-5-9-13-15/h4-13,17H,1-3H3 |
| InChIKey | WQASLSVIXOPDCK-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |