About pyrazolo[1,5-a]pyridin-4-ol
pyrazolo[1,5-a]pyridin-4-ol (PubChem CID 15257896) has the molecular formula C7H6N2O
and a molecular weight of 134.14 g/mol. Its IUPAC name is pyrazolo[1,5-a]pyridin-4-ol.
Molecular Properties
| Compound Name | pyrazolo[1,5-a]pyridin-4-ol |
| PubChem CID | 15257896 |
| Molecular Formula | C7H6N2O |
| Molecular Weight | 134.14 g/mol |
| Exact Mass | 134.05 |
| IUPAC Name | pyrazolo[1,5-a]pyridin-4-ol |
| SMILES | Oc1cccn2nccc12 |
| InChI | InChI=1S/C7H6N2O/c10-7-2-1-5-9-6(7)3-4-8-9/h1-5,10H |
| InChIKey | UYVZRUORQWAFPS-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.14 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyrazolo[1,5-a]pyridin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrazolo[1,5-a]pyridin-4-ol?
The IUPAC name of pyrazolo[1,5-a]pyridin-4-ol (CID 15257896) is pyrazolo[1,5-a]pyridin-4-ol.
What is the SMILES notation for pyrazolo[1,5-a]pyridin-4-ol?
The canonical SMILES for pyrazolo[1,5-a]pyridin-4-ol is Oc1cccn2nccc12.
What is the InChIKey of pyrazolo[1,5-a]pyridin-4-ol?
The InChIKey is UYVZRUORQWAFPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O/c10-7-2-1-5-9-6(7)3-4-8-9/h1-5,10H.
What are the key properties of pyrazolo[1,5-a]pyridin-4-ol?
pyrazolo[1,5-a]pyridin-4-ol has a molecular weight of 134.14 g/mol, XLogP of 1.04, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrazolo[1,5-a]pyridin-4-ol is sourced from PubChem (CID 15257896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).