About 4,5-dimethyl-2-propoxy-1,3,2-dioxaphospholane
4,5-dimethyl-2-propoxy-1,3,2-dioxaphospholane (PubChem CID 152581779) has the molecular formula C7H15O3P
and a molecular weight of 178.17 g/mol. Its IUPAC name is 4,5-dimethyl-2-propoxy-1,3,2-dioxaphospholane.
Molecular Properties
| Compound Name | 4,5-dimethyl-2-propoxy-1,3,2-dioxaphospholane |
| PubChem CID | 152581779 |
| Molecular Formula | C7H15O3P |
| Molecular Weight | 178.17 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | 4,5-dimethyl-2-propoxy-1,3,2-dioxaphospholane |
| SMILES | CCCOP1OC(C)C(C)O1 |
| InChI | InChI=1S/C7H15O3P/c1-4-5-8-11-9-6(2)7(3)10-11/h6-7H,4-5H2,1-3H3 |
| InChIKey | YTQAGMLSFKHPJH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.17 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dimethyl-2-propoxy-1,3,2-dioxaphospholane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-2-propoxy-1,3,2-dioxaphospholane?
The IUPAC name of 4,5-dimethyl-2-propoxy-1,3,2-dioxaphospholane (CID 152581779) is 4,5-dimethyl-2-propoxy-1,3,2-dioxaphospholane.
What is the SMILES notation for 4,5-dimethyl-2-propoxy-1,3,2-dioxaphospholane?
The canonical SMILES for 4,5-dimethyl-2-propoxy-1,3,2-dioxaphospholane is CCCOP1OC(C)C(C)O1.
What is the InChIKey of 4,5-dimethyl-2-propoxy-1,3,2-dioxaphospholane?
The InChIKey is YTQAGMLSFKHPJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15O3P/c1-4-5-8-11-9-6(2)7(3)10-11/h6-7H,4-5H2,1-3H3.
What are the key properties of 4,5-dimethyl-2-propoxy-1,3,2-dioxaphospholane?
4,5-dimethyl-2-propoxy-1,3,2-dioxaphospholane has a molecular weight of 178.17 g/mol, XLogP of 2.46, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-2-propoxy-1,3,2-dioxaphospholane is sourced from PubChem (CID 152581779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).