C12H13F3N2OS — CID 152584418
2-thiomorpholin-4-yl-5-(trifluoromethyl)benzamide (PubChem CID 152584418) has the molecular formula C12H13F3N2OS and a molecular weight of 290.31 g/mol. Its IUPAC name is 2-thiomorpholin-4-yl-5-(trifluoromethyl)benzamide.
| Compound Name | 2-thiomorpholin-4-yl-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 152584418 |
| Molecular Formula | C12H13F3N2OS |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 2-thiomorpholin-4-yl-5-(trifluoromethyl)benzamide |
| SMILES | NC(=O)c1cc(C(F)(F)F)ccc1N1CCSCC1 |
| InChI | InChI=1S/C12H13F3N2OS/c13-12(14,15)8-1-2-10(9(7-8)11(16)18)17-3-5-19-6-4-17/h1-2,7H,3-6H2,(H2,16,18) |
| InChIKey | YUDSAEBLAASLIB-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |